2-(2,6-diamino-4-methylsulfinylanilino)acetic acid

C9H13N3O3S — CID 21238965

IUPAC2-(2,6-diamino-4-methylsulfinylanilino)acetic acid
SMILESCS(=O)c1cc(N)c(NCC(=O)O)c(N)c1
InChIInChI=1S/C9H13N3O3S/c1-16(15)5-2-6(10)9(7(11)3-5)12-4-8(13)14/h2-3,12H,4,10-11H2,1H3,(H,13,14)
InChIKeyISKSUSIWUUBLFL-UHFFFAOYSA-N
MW243.29 g/mol
LogP0.08
Rot. Bonds4

About 2-(2,6-diamino-4-methylsulfinylanilino)acetic acid

2-(2,6-diamino-4-methylsulfinylanilino)acetic acid (PubChem CID 21238965) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-(2,6-diamino-4-methylsulfinylanilino)acetic acid.

Molecular Properties

Compound Name2-(2,6-diamino-4-methylsulfinylanilino)acetic acid
PubChem CID21238965
Molecular FormulaC9H13N3O3S
Molecular Weight243.29 g/mol
Exact Mass243.07
IUPAC Name2-(2,6-diamino-4-methylsulfinylanilino)acetic acid
SMILESCS(=O)c1cc(N)c(NCC(=O)O)c(N)c1
InChIInChI=1S/C9H13N3O3S/c1-16(15)5-2-6(10)9(7(11)3-5)12-4-8(13)14/h2-3,12H,4,10-11H2,1H3,(H,13,14)
InChIKeyISKSUSIWUUBLFL-UHFFFAOYSA-N
XLogP0.08
TPSA118.44 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.29
LogP ≤ 50.08
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-(2,6-diamino-4-methylsulfinylanilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,6-diamino-4-methylsulfinylanilino)acetic acid?
The IUPAC name of 2-(2,6-diamino-4-methylsulfinylanilino)acetic acid (CID 21238965) is 2-(2,6-diamino-4-methylsulfinylanilino)acetic acid.
What is the SMILES notation for 2-(2,6-diamino-4-methylsulfinylanilino)acetic acid?
The canonical SMILES for 2-(2,6-diamino-4-methylsulfinylanilino)acetic acid is CS(=O)c1cc(N)c(NCC(=O)O)c(N)c1.
What is the InChIKey of 2-(2,6-diamino-4-methylsulfinylanilino)acetic acid?
The InChIKey is ISKSUSIWUUBLFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3S/c1-16(15)5-2-6(10)9(7(11)3-5)12-4-8(13)14/h2-3,12H,4,10-11H2,1H3,(H,13,14).
What are the key properties of 2-(2,6-diamino-4-methylsulfinylanilino)acetic acid?
2-(2,6-diamino-4-methylsulfinylanilino)acetic acid has a molecular weight of 243.29 g/mol, XLogP of 0.08, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-diamino-4-methylsulfinylanilino)acetic acid is sourced from PubChem (CID 21238965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).