C32H31NO5P+ — CID 21239171
2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]ethoxy]ethyl-triphenylphosphanium (PubChem CID 21239171) has the molecular formula C32H31NO5P+ and a molecular weight of 540.58 g/mol. Its IUPAC name is 2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]ethoxy]ethyl-triphenylphosphanium.
| Compound Name | 2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]ethoxy]ethyl-triphenylphosphanium |
|---|---|
| PubChem CID | 21239171 |
| Molecular Formula | C32H31NO5P+ |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]ethoxy]ethyl-triphenylphosphanium |
| SMILES | O=C1c2ccccc2C(=O)N1OCCOCCOCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H31NO5P/c34-31-29-18-10-11-19-30(29)32(35)33(31)38-23-22-36-20-21-37-24-25-39(26-12-4-1-5-13-26,27-14-6-2-7-15-27)28-16-8-3-9-17-28/h1-19H,20-25H2/q+1 |
| InChIKey | FNQYYKVVJPJHSQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|