C6H8Cl3N3OS — CID 21239214
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-N-(2,2,2-trichloroethyl)hydroxylamine (PubChem CID 21239214) has the molecular formula C6H8Cl3N3OS and a molecular weight of 276.58 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-N-(2,2,2-trichloroethyl)hydroxylamine.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-N-(2,2,2-trichloroethyl)hydroxylamine |
|---|---|
| PubChem CID | 21239214 |
| Molecular Formula | C6H8Cl3N3OS |
| Molecular Weight | 276.58 g/mol |
| Exact Mass | 274.95 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-N-(2,2,2-trichloroethyl)hydroxylamine |
| SMILES | CCc1nnc(N(O)CC(Cl)(Cl)Cl)s1 |
| InChI | InChI=1S/C6H8Cl3N3OS/c1-2-4-10-11-5(14-4)12(13)3-6(7,8)9/h13H,2-3H2,1H3 |
| InChIKey | WSEGSRIDNMMEAB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|