C14H17N — CID 21239685
8-ethyl-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 21239685) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 8-ethyl-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 8-ethyl-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 21239685 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 8-ethyl-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | CCc1cccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C14H17N/c1-2-10-6-5-8-12-11-7-3-4-9-13(11)15-14(10)12/h5-6,8,15H,2-4,7,9H2,1H3 |
| InChIKey | IWTUDWGXXPGTIO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|