3,6,7-trimethyl-1H-indole-2-carboxylic acid

C12H13NO2 — CID 21239696

IUPAC3,6,7-trimethyl-1H-indole-2-carboxylic acid
SMILESCc1ccc2c(C)c(C(=O)O)[nH]c2c1C
InChIInChI=1S/C12H13NO2/c1-6-4-5-9-8(3)11(12(14)15)13-10(9)7(6)2/h4-5,13H,1-3H3,(H,14,15)
InChIKeyUKGLBTJPADEUCX-UHFFFAOYSA-N
MW203.24 g/mol
LogP2.79
Rot. Bonds1

About 3,6,7-trimethyl-1H-indole-2-carboxylic acid

3,6,7-trimethyl-1H-indole-2-carboxylic acid (PubChem CID 21239696) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3,6,7-trimethyl-1H-indole-2-carboxylic acid.

Molecular Properties

Compound Name3,6,7-trimethyl-1H-indole-2-carboxylic acid
PubChem CID21239696
Molecular FormulaC12H13NO2
Molecular Weight203.24 g/mol
Exact Mass203.09
IUPAC Name3,6,7-trimethyl-1H-indole-2-carboxylic acid
SMILESCc1ccc2c(C)c(C(=O)O)[nH]c2c1C
InChIInChI=1S/C12H13NO2/c1-6-4-5-9-8(3)11(12(14)15)13-10(9)7(6)2/h4-5,13H,1-3H3,(H,14,15)
InChIKeyUKGLBTJPADEUCX-UHFFFAOYSA-N
XLogP2.79
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 52.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}

Analyze 3,6,7-trimethyl-1H-indole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,6,7-trimethyl-1H-indole-2-carboxylic acid?
The IUPAC name of 3,6,7-trimethyl-1H-indole-2-carboxylic acid (CID 21239696) is 3,6,7-trimethyl-1H-indole-2-carboxylic acid.
What is the SMILES notation for 3,6,7-trimethyl-1H-indole-2-carboxylic acid?
The canonical SMILES for 3,6,7-trimethyl-1H-indole-2-carboxylic acid is Cc1ccc2c(C)c(C(=O)O)[nH]c2c1C.
What is the InChIKey of 3,6,7-trimethyl-1H-indole-2-carboxylic acid?
The InChIKey is UKGLBTJPADEUCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-6-4-5-9-8(3)11(12(14)15)13-10(9)7(6)2/h4-5,13H,1-3H3,(H,14,15).
What are the key properties of 3,6,7-trimethyl-1H-indole-2-carboxylic acid?
3,6,7-trimethyl-1H-indole-2-carboxylic acid has a molecular weight of 203.24 g/mol, XLogP of 2.79, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6,7-trimethyl-1H-indole-2-carboxylic acid is sourced from PubChem (CID 21239696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).