C11H13ClN2O5 — CID 21240506
4,5-dimethyl-1,3-dihydro-1,5-benzodiazepin-5-ium-2-one perchlorate (PubChem CID 21240506) has the molecular formula C11H13ClN2O5 and a molecular weight of 288.69 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-dihydro-1,5-benzodiazepin-5-ium-2-one perchlorate.
| Compound Name | 4,5-dimethyl-1,3-dihydro-1,5-benzodiazepin-5-ium-2-one perchlorate |
|---|---|
| PubChem CID | 21240506 |
| Molecular Formula | C11H13ClN2O5 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4,5-dimethyl-1,3-dihydro-1,5-benzodiazepin-5-ium-2-one perchlorate |
| SMILES | CC1=[N+](C)c2ccccc2NC(=O)C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C11H12N2O.ClHO4/c1-8-7-11(14)12-9-5-3-4-6-10(9)13(8)2;2-1(3,4)5/h3-6H,7H2,1-2H3;(H,2,3,4,5) |
| InChIKey | NYFJERHGYZPSSJ-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|