C12H8N4 — CID 21240972
2,3,9,10-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),11(15),12-heptaene (PubChem CID 21240972) has the molecular formula C12H8N4 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2,3,9,10-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),11(15),12-heptaene.
| Compound Name | 2,3,9,10-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),11(15),12-heptaene |
|---|---|
| PubChem CID | 21240972 |
| Molecular Formula | C12H8N4 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2,3,9,10-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),11(15),12-heptaene |
| SMILES | c1cc2nnc3cccc4[nH][nH]c(c1)c2c34 |
| InChI | InChI=1S/C12H8N4/c1-3-7-11-8(4-1)14-16-10-6-2-5-9(12(10)11)15-13-7/h1-6,13,15H |
| InChIKey | FULYDSBHCONKHA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|