About morpholine;1-morpholin-4-ylpropan-1-one
morpholine;1-morpholin-4-ylpropan-1-one (PubChem CID 21241937) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is morpholine;1-morpholin-4-ylpropan-1-one.
Molecular Properties
| Compound Name | morpholine;1-morpholin-4-ylpropan-1-one |
| PubChem CID | 21241937 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | morpholine;1-morpholin-4-ylpropan-1-one |
| SMILES | C1COCCN1.CCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C7H13NO2.C4H9NO/c1-2-7(9)8-3-5-10-6-4-8;1-3-6-4-2-5-1/h2-6H2,1H3;5H,1-4H2 |
| InChIKey | PPXLRZZVBXIRRU-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze morpholine;1-morpholin-4-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;1-morpholin-4-ylpropan-1-one?
The IUPAC name of morpholine;1-morpholin-4-ylpropan-1-one (CID 21241937) is morpholine;1-morpholin-4-ylpropan-1-one.
What is the SMILES notation for morpholine;1-morpholin-4-ylpropan-1-one?
The canonical SMILES for morpholine;1-morpholin-4-ylpropan-1-one is C1COCCN1.CCC(=O)N1CCOCC1.
What is the InChIKey of morpholine;1-morpholin-4-ylpropan-1-one?
The InChIKey is PPXLRZZVBXIRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C4H9NO/c1-2-7(9)8-3-5-10-6-4-8;1-3-6-4-2-5-1/h2-6H2,1H3;5H,1-4H2.
What are the key properties of morpholine;1-morpholin-4-ylpropan-1-one?
morpholine;1-morpholin-4-ylpropan-1-one has a molecular weight of 230.31 g/mol, XLogP of -0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;1-morpholin-4-ylpropan-1-one is sourced from PubChem (CID 21241937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).