C15H21NO5 — CID 21242026
benzyl N-[1-(1,3-dioxan-2-yl)-3-hydroxypropan-2-yl]carbamate (PubChem CID 21242026) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is benzyl N-[1-(1,3-dioxan-2-yl)-3-hydroxypropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(1,3-dioxan-2-yl)-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 21242026 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | benzyl N-[1-(1,3-dioxan-2-yl)-3-hydroxypropan-2-yl]carbamate |
| SMILES | O=C(NC(CO)CC1OCCCO1)OCc1ccccc1 |
| InChI | InChI=1S/C15H21NO5/c17-10-13(9-14-19-7-4-8-20-14)16-15(18)21-11-12-5-2-1-3-6-12/h1-3,5-6,13-14,17H,4,7-11H2,(H,16,18) |
| InChIKey | IWXBTNJISIKFME-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |