About 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine
1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine (PubChem CID 21242212) has the molecular formula C5H11N3
and a molecular weight of 113.16 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine |
| PubChem CID | 21242212 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine |
| SMILES | CC(N)C1=NCCN1 |
| InChI | InChI=1S/C5H11N3/c1-4(6)5-7-2-3-8-5/h4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | FJXILFHTWZGIGF-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine (CID 21242212) is 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine is CC(N)C1=NCCN1.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine?
The InChIKey is FJXILFHTWZGIGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3/c1-4(6)5-7-2-3-8-5/h4H,2-3,6H2,1H3,(H,7,8).
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine?
1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine has a molecular weight of 113.16 g/mol, XLogP of -0.66, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-yl)ethanamine is sourced from PubChem (CID 21242212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).