C25H42O4 — CID 21242275
[(2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienyl] 2,2-dimethylpropanoate (PubChem CID 21242275) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is [(2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 21242275 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | [(2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(CC/C(C)=C/CC/C(C)=C/COC(=O)C(C)(C)C)OC1CCCCO1 |
| InChI | InChI=1S/C25H42O4/c1-19(2)22(29-23-13-8-9-17-27-23)15-14-20(3)11-10-12-21(4)16-18-28-24(26)25(5,6)7/h11,16,22-23H,1,8-10,12-15,17-18H2,2-7H3/b20-11+,21-16+ |
| InChIKey | DSBIQSMYNRUBPL-DHEAZRKOSA-N |
| XLogP | 6.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|