C20H34O3 — CID 21242304
(6Z,10Z)-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-1,6,10-trien-3-ol (PubChem CID 21242304) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (6Z,10Z)-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-1,6,10-trien-3-ol.
| Compound Name | (6Z,10Z)-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-1,6,10-trien-3-ol |
|---|---|
| PubChem CID | 21242304 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (6Z,10Z)-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-1,6,10-trien-3-ol |
| SMILES | C=C(C)C(O)CC/C(C)=C\CC/C(C)=C\COC1CCCCO1 |
| InChI | InChI=1S/C20H34O3/c1-16(2)19(21)12-11-17(3)8-7-9-18(4)13-15-23-20-10-5-6-14-22-20/h8,13,19-21H,1,5-7,9-12,14-15H2,2-4H3/b17-8-,18-13- |
| InChIKey | UNWDHEHTEHNETI-VXKKKROUSA-N |
| XLogP | 4.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|