C20H32O4 — CID 21242310
(2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienoic acid (PubChem CID 21242310) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienoic acid.
| Compound Name | (2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienoic acid |
|---|---|
| PubChem CID | 21242310 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienoic acid |
| SMILES | C=C(C)C(CC/C(C)=C/CC/C(C)=C/C(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C20H32O4/c1-15(2)18(24-20-10-5-6-13-23-20)12-11-16(3)8-7-9-17(4)14-19(21)22/h8,14,18,20H,1,5-7,9-13H2,2-4H3,(H,21,22)/b16-8+,17-14+ |
| InChIKey | AELOLGXHCKZBEY-IFTYSCLRSA-N |
| XLogP | 5.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|