C18H30O3 — CID 21242325
(2E,6E)-10,10-diethoxy-3,7-dimethyldodeca-2,6-dien-11-yn-1-ol (PubChem CID 21242325) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (2E,6E)-10,10-diethoxy-3,7-dimethyldodeca-2,6-dien-11-yn-1-ol.
| Compound Name | (2E,6E)-10,10-diethoxy-3,7-dimethyldodeca-2,6-dien-11-yn-1-ol |
|---|---|
| PubChem CID | 21242325 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (2E,6E)-10,10-diethoxy-3,7-dimethyldodeca-2,6-dien-11-yn-1-ol |
| SMILES | C#CC(CC/C(C)=C/CC/C(C)=C/CO)(OCC)OCC |
| InChI | InChI=1S/C18H30O3/c1-6-18(20-7-2,21-8-3)14-12-16(4)10-9-11-17(5)13-15-19/h1,10,13,19H,7-9,11-12,14-15H2,2-5H3/b16-10+,17-13+ |
| InChIKey | GDGHIUCXPHPANW-QKXOVSGLSA-N |
| XLogP | 3.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|