About 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane
2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane (PubChem CID 21242336) has the molecular formula C20H36O3
and a molecular weight of 324.51 g/mol. Its IUPAC name is 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane.
Molecular Properties
| Compound Name | 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane |
| PubChem CID | 21242336 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane |
| SMILES | C/C(=C\CCC(C)CCOC1CCCCO1)CCC1OC1(C)C |
| InChI | InChI=1S/C20H36O3/c1-16(11-12-18-20(3,4)23-18)8-7-9-17(2)13-15-22-19-10-5-6-14-21-19/h8,17-19H,5-7,9-15H2,1-4H3/b16-8+ |
| InChIKey | XBUZNYQJVLQYFP-LZYBPNLTSA-N |
| XLogP | 5.24 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane?
The IUPAC name of 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane (CID 21242336) is 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane.
What is the SMILES notation for 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane?
The canonical SMILES for 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane is C/C(=C\CCC(C)CCOC1CCCCO1)CCC1OC1(C)C.
What is the InChIKey of 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane?
The InChIKey is XBUZNYQJVLQYFP-LZYBPNLTSA-N. The full InChI is InChI=1S/C20H36O3/c1-16(11-12-18-20(3,4)23-18)8-7-9-17(2)13-15-22-19-10-5-6-14-21-19/h8,17-19H,5-7,9-15H2,1-4H3/b16-8+.
What are the key properties of 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane?
2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane has a molecular weight of 324.51 g/mol, XLogP of 5.24, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnon-6-enoxy]oxane is sourced from PubChem (CID 21242336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).