C21H38O3Si — CID 21242345
(2E,6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienoic acid (PubChem CID 21242345) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (2E,6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienoic acid.
| Compound Name | (2E,6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienoic acid |
|---|---|
| PubChem CID | 21242345 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (2E,6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienoic acid |
| SMILES | C=C(C)C(CC/C(C)=C/CC/C(C)=C/C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O3Si/c1-16(2)19(24-25(8,9)21(5,6)7)14-13-17(3)11-10-12-18(4)15-20(22)23/h11,15,19H,1,10,12-14H2,2-9H3,(H,22,23)/b17-11+,18-15+ |
| InChIKey | SWCSFERANRBBIA-OVHYJKADSA-N |
| XLogP | 6.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|