C23H36O3 — CID 21242356
(5E,9E)-6,10,14-trimethyl-13-(oxan-2-yloxy)pentadeca-5,9,14-trien-2-yn-4-ol (PubChem CID 21242356) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (5E,9E)-6,10,14-trimethyl-13-(oxan-2-yloxy)pentadeca-5,9,14-trien-2-yn-4-ol.
| Compound Name | (5E,9E)-6,10,14-trimethyl-13-(oxan-2-yloxy)pentadeca-5,9,14-trien-2-yn-4-ol |
|---|---|
| PubChem CID | 21242356 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (5E,9E)-6,10,14-trimethyl-13-(oxan-2-yloxy)pentadeca-5,9,14-trien-2-yn-4-ol |
| SMILES | C=C(C)C(CC/C(C)=C/CC/C(C)=C/C(O)C#CC)OC1CCCCO1 |
| InChI | InChI=1S/C23H36O3/c1-6-10-21(24)17-20(5)12-9-11-19(4)14-15-22(18(2)3)26-23-13-7-8-16-25-23/h11,17,21-24H,2,7-9,12-16H2,1,3-5H3/b19-11+,20-17+ |
| InChIKey | KIHYQFWXNBZLFD-HPCQEULDSA-N |
| XLogP | 5.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|