C15H22O3 — CID 21242366
(2E,4E,6E)-10-hydroxy-3,7,11-trimethyldodeca-2,4,6,11-tetraenoic acid (PubChem CID 21242366) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2E,4E,6E)-10-hydroxy-3,7,11-trimethyldodeca-2,4,6,11-tetraenoic acid.
| Compound Name | (2E,4E,6E)-10-hydroxy-3,7,11-trimethyldodeca-2,4,6,11-tetraenoic acid |
|---|---|
| PubChem CID | 21242366 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2E,4E,6E)-10-hydroxy-3,7,11-trimethyldodeca-2,4,6,11-tetraenoic acid |
| SMILES | C=C(C)C(O)CC/C(C)=C/C=C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C15H22O3/c1-11(2)14(16)9-8-12(3)6-5-7-13(4)10-15(17)18/h5-7,10,14,16H,1,8-9H2,2-4H3,(H,17,18)/b7-5+,12-6+,13-10+ |
| InChIKey | UCYUGMMKRQKFCE-SOYAUXHKSA-N |
| XLogP | 3.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|