C20H34O3 — CID 21242369
(2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trien-1-ol (PubChem CID 21242369) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trien-1-ol.
| Compound Name | (2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trien-1-ol |
|---|---|
| PubChem CID | 21242369 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (2E,6E)-3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trien-1-ol |
| SMILES | C=C(C)C(CC/C(C)=C/CC/C(C)=C/CO)OC1CCCCO1 |
| InChI | InChI=1S/C20H34O3/c1-16(2)19(23-20-10-5-6-15-22-20)12-11-17(3)8-7-9-18(4)13-14-21/h8,13,19-21H,1,5-7,9-12,14-15H2,2-4H3/b17-8+,18-13+ |
| InChIKey | BNHJZIFXLWWWNM-MCPYHEBDSA-N |
| XLogP | 4.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|