C13H23NO2 — CID 21242529
methyl 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylamino)acetate (PubChem CID 21242529) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is methyl 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylamino)acetate.
| Compound Name | methyl 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylamino)acetate |
|---|---|
| PubChem CID | 21242529 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | methyl 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylamino)acetate |
| SMILES | COC(=O)CNC1CCCC2CCCCC21 |
| InChI | InChI=1S/C13H23NO2/c1-16-13(15)9-14-12-8-4-6-10-5-2-3-7-11(10)12/h10-12,14H,2-9H2,1H3 |
| InChIKey | FRYKHOCORABBOL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |