C11H15NOS — CID 21242902
7-methylsulfinyl-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 21242902) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 7-methylsulfinyl-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | 7-methylsulfinyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 21242902 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 7-methylsulfinyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | CS(=O)c1ccc2c(c1)CCNCC2 |
| InChI | InChI=1S/C11H15NOS/c1-14(13)11-3-2-9-4-6-12-7-5-10(9)8-11/h2-3,8,12H,4-7H2,1H3 |
| InChIKey | QAJQRYLPWKBILY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |