C10H16N6O — CID 21243162
N-[4-amino-6-(cyclopropylamino)-1,3,5-triazin-2-yl]butanamide (PubChem CID 21243162) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is N-[4-amino-6-(cyclopropylamino)-1,3,5-triazin-2-yl]butanamide.
| Compound Name | N-[4-amino-6-(cyclopropylamino)-1,3,5-triazin-2-yl]butanamide |
|---|---|
| PubChem CID | 21243162 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | N-[4-amino-6-(cyclopropylamino)-1,3,5-triazin-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nc(N)nc(NC2CC2)n1 |
| InChI | InChI=1S/C10H16N6O/c1-2-3-7(17)13-10-15-8(11)14-9(16-10)12-6-4-5-6/h6H,2-5H2,1H3,(H4,11,12,13,14,15,16,17) |
| InChIKey | KCFHCGYLQBDSTI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |