C25H28N2OS — CID 21243238
[3-[2-(2,4,5,6-tetrahydro-1H-benzo[f]isoquinolin-3-yl)ethylsulfanylmethyl]-1H-indol-7-yl]methanol (PubChem CID 21243238) has the molecular formula C25H28N2OS and a molecular weight of 404.58 g/mol. Its IUPAC name is [3-[2-(2,4,5,6-tetrahydro-1H-benzo[f]isoquinolin-3-yl)ethylsulfanylmethyl]-1H-indol-7-yl]methanol.
| Compound Name | [3-[2-(2,4,5,6-tetrahydro-1H-benzo[f]isoquinolin-3-yl)ethylsulfanylmethyl]-1H-indol-7-yl]methanol |
|---|---|
| PubChem CID | 21243238 |
| Molecular Formula | C25H28N2OS |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | [3-[2-(2,4,5,6-tetrahydro-1H-benzo[f]isoquinolin-3-yl)ethylsulfanylmethyl]-1H-indol-7-yl]methanol |
| SMILES | OCc1cccc2c(CSCCN3CCC4=C(CCc5ccccc54)C3)c[nH]c12 |
| InChI | InChI=1S/C25H28N2OS/c28-16-20-5-3-7-24-21(14-26-25(20)24)17-29-13-12-27-11-10-23-19(15-27)9-8-18-4-1-2-6-22(18)23/h1-7,14,26,28H,8-13,15-17H2 |
| InChIKey | SMPRBILNOKPGSS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|