C8H16N+ — CID 21243475
N,N-bis(ethenyl)butan-1-amine;hydron (PubChem CID 21243475) has the molecular formula C8H16N+ and a molecular weight of 126.22 g/mol. Its IUPAC name is N,N-bis(ethenyl)butan-1-amine;hydron.
| Compound Name | N,N-bis(ethenyl)butan-1-amine;hydron |
|---|---|
| PubChem CID | 21243475 |
| Molecular Formula | C8H16N+ |
| Molecular Weight | 126.22 g/mol |
| Exact Mass | 126.13 |
| IUPAC Name | N,N-bis(ethenyl)butan-1-amine;hydron |
| SMILES | C=CN(C=C)CCCC.[H+] |
| InChI | InChI=1S/C8H15N/c1-4-7-8-9(5-2)6-3/h5-6H,2-4,7-8H2,1H3/p+1 |
| InChIKey | RBMPGGGPQUVWBO-UHFFFAOYSA-O |
| XLogP | 2.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |