About diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate
diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate (PubChem CID 21243556) has the molecular formula C11H16O7
and a molecular weight of 260.24 g/mol. Its IUPAC name is diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate |
| PubChem CID | 21243556 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1OC(C)=C(O)C1(O)C(=O)OCC |
| InChI | InChI=1S/C11H16O7/c1-4-16-9(13)8-11(15,10(14)17-5-2)7(12)6(3)18-8/h8,12,15H,4-5H2,1-3H3 |
| InChIKey | IGPXMNFMRSJDFV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate?
The IUPAC name of diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate (CID 21243556) is diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate.
What is the SMILES notation for diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate?
The canonical SMILES for diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate is CCOC(=O)C1OC(C)=C(O)C1(O)C(=O)OCC.
What is the InChIKey of diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate?
The InChIKey is IGPXMNFMRSJDFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O7/c1-4-16-9(13)8-11(15,10(14)17-5-2)7(12)6(3)18-8/h8,12,15H,4-5H2,1-3H3.
What are the key properties of diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate?
diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate has a molecular weight of 260.24 g/mol, XLogP of 0.03, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 3,4-dihydroxy-5-methyl-2H-furan-2,3-dicarboxylate is sourced from PubChem (CID 21243556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).