C13H10F12O2 — CID 21243760
1,1,2,3,3,3-hexafluoro-2-[5-(1,1,1,2,3,3-hexafluoro-3-hydroxypropan-2-yl)-5-methylcyclohexa-1,3-dien-1-yl]propan-1-ol (PubChem CID 21243760) has the molecular formula C13H10F12O2 and a molecular weight of 426.20 g/mol. Its IUPAC name is 1,1,2,3,3,3-hexafluoro-2-[5-(1,1,1,2,3,3-hexafluoro-3-hydroxypropan-2-yl)-5-methylcyclohexa-1,3-dien-1-yl]propan-1-ol.
| Compound Name | 1,1,2,3,3,3-hexafluoro-2-[5-(1,1,1,2,3,3-hexafluoro-3-hydroxypropan-2-yl)-5-methylcyclohexa-1,3-dien-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 21243760 |
| Molecular Formula | C13H10F12O2 |
| Molecular Weight | 426.20 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 1,1,2,3,3,3-hexafluoro-2-[5-(1,1,1,2,3,3-hexafluoro-3-hydroxypropan-2-yl)-5-methylcyclohexa-1,3-dien-1-yl]propan-1-ol |
| SMILES | CC1(C(F)(C(O)(F)F)C(F)(F)F)C=CC=C(C(F)(C(O)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H10F12O2/c1-7(9(15,11(19,20)21)13(24,25)27)4-2-3-6(5-7)8(14,10(16,17)18)12(22,23)26/h2-4,26-27H,5H2,1H3 |
| InChIKey | CSSHPFQOBQYKFN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.20 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |