About 1,2,3,6-tetramethylcyclohexene
1,2,3,6-tetramethylcyclohexene (PubChem CID 21243938) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is 1,2,3,6-tetramethylcyclohexene.
Molecular Properties
| Compound Name | 1,2,3,6-tetramethylcyclohexene |
| PubChem CID | 21243938 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | 1,2,3,6-tetramethylcyclohexene |
| SMILES | CC1=C(C)C(C)CCC1C |
| InChI | InChI=1S/C10H18/c1-7-5-6-8(2)10(4)9(7)3/h7-8H,5-6H2,1-4H3 |
| InChIKey | GZZBBYJSUJRPMA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3,6-tetramethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,6-tetramethylcyclohexene?
The IUPAC name of 1,2,3,6-tetramethylcyclohexene (CID 21243938) is 1,2,3,6-tetramethylcyclohexene.
What is the SMILES notation for 1,2,3,6-tetramethylcyclohexene?
The canonical SMILES for 1,2,3,6-tetramethylcyclohexene is CC1=C(C)C(C)CCC1C.
What is the InChIKey of 1,2,3,6-tetramethylcyclohexene?
The InChIKey is GZZBBYJSUJRPMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18/c1-7-5-6-8(2)10(4)9(7)3/h7-8H,5-6H2,1-4H3.
What are the key properties of 1,2,3,6-tetramethylcyclohexene?
1,2,3,6-tetramethylcyclohexene has a molecular weight of 138.25 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,6-tetramethylcyclohexene is sourced from PubChem (CID 21243938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).