About methyloctylsiloxane
methyloctylsiloxane (PubChem CID 21243982) has the molecular formula C9H21OSi
and a molecular weight of 173.35 g/mol.
Molecular Properties
| Compound Name | methyloctylsiloxane |
| PubChem CID | 21243982 |
| Molecular Formula | C9H21OSi |
| Molecular Weight | 173.35 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | — |
| SMILES | CCCCCCCC[Si](C)O |
| InChI | InChI=1S/C9H21OSi/c1-3-4-5-6-7-8-9-11(2)10/h10H,3-9H2,1-2H3 |
| InChIKey | WUTBAYNZRGBUGK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyloctylsiloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyloctylsiloxane?
The IUPAC name of methyloctylsiloxane (CID 21243982) is not available.
What is the SMILES notation for methyloctylsiloxane?
The canonical SMILES for methyloctylsiloxane is CCCCCCCC[Si](C)O.
What is the InChIKey of methyloctylsiloxane?
The InChIKey is WUTBAYNZRGBUGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21OSi/c1-3-4-5-6-7-8-9-11(2)10/h10H,3-9H2,1-2H3.
What are the key properties of methyloctylsiloxane?
methyloctylsiloxane has a molecular weight of 173.35 g/mol, XLogP of 2.96, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyloctylsiloxane is sourced from PubChem (CID 21243982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).