C8H12N4O6S — CID 21244262
2-oxo-3-[[2-(2-oxoimidazolidin-1-yl)acetyl]amino]azetidine-1-sulfonic acid (PubChem CID 21244262) has the molecular formula C8H12N4O6S and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-oxo-3-[[2-(2-oxoimidazolidin-1-yl)acetyl]amino]azetidine-1-sulfonic acid.
| Compound Name | 2-oxo-3-[[2-(2-oxoimidazolidin-1-yl)acetyl]amino]azetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 21244262 |
| Molecular Formula | C8H12N4O6S |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-oxo-3-[[2-(2-oxoimidazolidin-1-yl)acetyl]amino]azetidine-1-sulfonic acid |
| SMILES | O=C(CN1CCNC1=O)NC1CN(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C8H12N4O6S/c13-6(4-11-2-1-9-8(11)15)10-5-3-12(7(5)14)19(16,17)18/h5H,1-4H2,(H,9,15)(H,10,13)(H,16,17,18) |
| InChIKey | VFNGBOMFEDDTSO-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|