C22H17F3N4O7S — CID 21244513
2-oxo-3-[[2-[[4-oxo-7-(trifluoromethyl)-1H-quinoline-3-carbonyl]amino]-2-phenylacetyl]amino]azetidine-1-sulfonic acid (PubChem CID 21244513) has the molecular formula C22H17F3N4O7S and a molecular weight of 538.46 g/mol. Its IUPAC name is 2-oxo-3-[[2-[[4-oxo-7-(trifluoromethyl)-1H-quinoline-3-carbonyl]amino]-2-phenylacetyl]amino]azetidine-1-sulfonic acid.
| Compound Name | 2-oxo-3-[[2-[[4-oxo-7-(trifluoromethyl)-1H-quinoline-3-carbonyl]amino]-2-phenylacetyl]amino]azetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 21244513 |
| Molecular Formula | C22H17F3N4O7S |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 2-oxo-3-[[2-[[4-oxo-7-(trifluoromethyl)-1H-quinoline-3-carbonyl]amino]-2-phenylacetyl]amino]azetidine-1-sulfonic acid |
| SMILES | O=C(NC(C(=O)NC1CN(S(=O)(=O)O)C1=O)c1ccccc1)c1c[nH]c2cc(C(F)(F)F)ccc2c1=O |
| InChI | InChI=1S/C22H17F3N4O7S/c23-22(24,25)12-6-7-13-15(8-12)26-9-14(18(13)30)19(31)28-17(11-4-2-1-3-5-11)20(32)27-16-10-29(21(16)33)37(34,35)36/h1-9,16-17H,10H2,(H,26,30)(H,27,32)(H,28,31)(H,34,35,36) |
| InChIKey | GKKFSJSZJJWWEI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 165.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|