C22H27N5O5 — CID 21244878
4-cyclohexyl-2,3-dioxo-N-[2-oxo-2-[(2-oxoazetidin-3-yl)amino]-1-phenylethyl]piperazine-1-carboxamide (PubChem CID 21244878) has the molecular formula C22H27N5O5 and a molecular weight of 441.49 g/mol. Its IUPAC name is 4-cyclohexyl-2,3-dioxo-N-[2-oxo-2-[(2-oxoazetidin-3-yl)amino]-1-phenylethyl]piperazine-1-carboxamide.
| Compound Name | 4-cyclohexyl-2,3-dioxo-N-[2-oxo-2-[(2-oxoazetidin-3-yl)amino]-1-phenylethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 21244878 |
| Molecular Formula | C22H27N5O5 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 4-cyclohexyl-2,3-dioxo-N-[2-oxo-2-[(2-oxoazetidin-3-yl)amino]-1-phenylethyl]piperazine-1-carboxamide |
| SMILES | O=C1NCC1NC(=O)C(NC(=O)N1CCN(C2CCCCC2)C(=O)C1=O)c1ccccc1 |
| InChI | InChI=1S/C22H27N5O5/c28-18-16(13-23-18)24-19(29)17(14-7-3-1-4-8-14)25-22(32)27-12-11-26(20(30)21(27)31)15-9-5-2-6-10-15/h1,3-4,7-8,15-17H,2,5-6,9-13H2,(H,23,28)(H,24,29)(H,25,32) |
| InChIKey | ZYFIPLMTQKMFRZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|