About bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+)
bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+) (PubChem CID 21245685) has the molecular formula C22H42Si4U
and a molecular weight of 656.95 g/mol. Its IUPAC name is bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+).
Molecular Properties
| Compound Name | bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+) |
| PubChem CID | 21245685 |
| Molecular Formula | C22H42Si4U |
| Molecular Weight | 656.95 g/mol |
| Exact Mass | 656.29 |
| IUPAC Name | bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+) |
| SMILES | C[Si](C)(C)C1=[C-]CC=C1[Si](C)(C)C.C[Si](C)(C)C1=[C-]CC=C1[Si](C)(C)C.[U+2] |
| InChI | InChI=1S/2C11H21Si2.U/c2*1-12(2,3)10-8-7-9-11(10)13(4,5)6;/h2*8H,7H2,1-6H3;/q2*-1;+2 |
| InChIKey | PZALDPPZXLPLEB-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 656.95 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+)?
The IUPAC name of bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+) (CID 21245685) is bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+).
What is the SMILES notation for bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+)?
The canonical SMILES for bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+) is C[Si](C)(C)C1=[C-]CC=C1[Si](C)(C)C.C[Si](C)(C)C1=[C-]CC=C1[Si](C)(C)C.[U+2].
What is the InChIKey of bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+)?
The InChIKey is PZALDPPZXLPLEB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H21Si2.U/c2*1-12(2,3)10-8-7-9-11(10)13(4,5)6;/h2*8H,7H2,1-6H3;/q2*-1;+2.
What are the key properties of bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+)?
bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+) has a molecular weight of 656.95 g/mol, XLogP of 7.60, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethyl-(5-trimethylsilylcyclopenta-1,4-dien-1-yl)silane);uranium(2+) is sourced from PubChem (CID 21245685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).