About (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate
(1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate (PubChem CID 21246039) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate.
Molecular Properties
| Compound Name | (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate |
| PubChem CID | 21246039 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate |
| SMILES | CCC(=O)OC1(C)CC=CC=C1C |
| InChI | InChI=1S/C11H16O2/c1-4-10(12)13-11(3)8-6-5-7-9(11)2/h5-7H,4,8H2,1-3H3 |
| InChIKey | YGKXWUXDOUWEBZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate?
The IUPAC name of (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate (CID 21246039) is (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate.
What is the SMILES notation for (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate?
The canonical SMILES for (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate is CCC(=O)OC1(C)CC=CC=C1C.
What is the InChIKey of (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate?
The InChIKey is YGKXWUXDOUWEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-4-10(12)13-11(3)8-6-5-7-9(11)2/h5-7H,4,8H2,1-3H3.
What are the key properties of (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate?
(1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate has a molecular weight of 180.25 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dimethylcyclohexa-2,4-dien-1-yl) propanoate is sourced from PubChem (CID 21246039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).