About [1]benzofuro[2,3-c]pyridazine
[1]benzofuro[2,3-c]pyridazine (PubChem CID 21246139) has the molecular formula C10H6N2O
and a molecular weight of 170.17 g/mol. Its IUPAC name is [1]benzofuro[2,3-c]pyridazine.
Molecular Properties
| Compound Name | [1]benzofuro[2,3-c]pyridazine |
| PubChem CID | 21246139 |
| Molecular Formula | C10H6N2O |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | [1]benzofuro[2,3-c]pyridazine |
| SMILES | c1ccc2c(c1)oc1nnccc12 |
| InChI | InChI=1S/C10H6N2O/c1-2-4-9-7(3-1)8-5-6-11-12-10(8)13-9/h1-6H |
| InChIKey | ASXFWONWVJSQKP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1]benzofuro[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzofuro[2,3-c]pyridazine?
The IUPAC name of [1]benzofuro[2,3-c]pyridazine (CID 21246139) is [1]benzofuro[2,3-c]pyridazine.
What is the SMILES notation for [1]benzofuro[2,3-c]pyridazine?
The canonical SMILES for [1]benzofuro[2,3-c]pyridazine is c1ccc2c(c1)oc1nnccc12.
What is the InChIKey of [1]benzofuro[2,3-c]pyridazine?
The InChIKey is ASXFWONWVJSQKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O/c1-2-4-9-7(3-1)8-5-6-11-12-10(8)13-9/h1-6H.
What are the key properties of [1]benzofuro[2,3-c]pyridazine?
[1]benzofuro[2,3-c]pyridazine has a molecular weight of 170.17 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzofuro[2,3-c]pyridazine is sourced from PubChem (CID 21246139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).