About 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one
7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one (PubChem CID 2124708) has the molecular formula C19H17N3O4
and a molecular weight of 351.36 g/mol. Its IUPAC name is 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one |
| PubChem CID | 2124708 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one |
| SMILES | Cc1cc(C)c(C(=O)Cn2cnc3cc([N+](=O)[O-])ccc3c2=O)cc1C |
| InChI | InChI=1S/C19H17N3O4/c1-11-6-13(3)16(7-12(11)2)18(23)9-21-10-20-17-8-14(22(25)26)4-5-15(17)19(21)24/h4-8,10H,9H2,1-3H3 |
| InChIKey | IJKOIARWARYDRQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one?
The IUPAC name of 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one (CID 2124708) is 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one.
What is the SMILES notation for 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one?
The canonical SMILES for 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one is Cc1cc(C)c(C(=O)Cn2cnc3cc([N+](=O)[O-])ccc3c2=O)cc1C.
What is the InChIKey of 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one?
The InChIKey is IJKOIARWARYDRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O4/c1-11-6-13(3)16(7-12(11)2)18(23)9-21-10-20-17-8-14(22(25)26)4-5-15(17)19(21)24/h4-8,10H,9H2,1-3H3.
What are the key properties of 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one?
7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one has a molecular weight of 351.36 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]quinazolin-4-one is sourced from PubChem (CID 2124708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).