About benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane
benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane (PubChem CID 21247290) has the molecular formula C14H26O7P2S2
and a molecular weight of 432.44 g/mol. Its IUPAC name is benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane |
| PubChem CID | 21247290 |
| Molecular Formula | C14H26O7P2S2 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)OP(=S)(OCC)OCC.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C8H20O5P2S2.C6H6O2/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4;7-5-1-2-6(8)4-3-5/h5-8H2,1-4H3;1-4,7-8H |
| InChIKey | VONQOXSKTCDCER-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane?
The IUPAC name of benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane (CID 21247290) is benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane.
What is the SMILES notation for benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane?
The canonical SMILES for benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane is CCOP(=S)(OCC)OP(=S)(OCC)OCC.Oc1ccc(O)cc1.
What is the InChIKey of benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane?
The InChIKey is VONQOXSKTCDCER-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20O5P2S2.C6H6O2/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4;7-5-1-2-6(8)4-3-5/h5-8H2,1-4H3;1-4,7-8H.
What are the key properties of benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane?
benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane has a molecular weight of 432.44 g/mol, XLogP of 4.70, 10 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 21247290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).