C14H26O7P2S2 — CID 21247290
benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane (PubChem CID 21247290) has the molecular formula C14H26O7P2S2 and a molecular weight of 432.44 g/mol. Its IUPAC name is benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 21247290 |
| Molecular Formula | C14H26O7P2S2 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | benzene-1,4-diol;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)OP(=S)(OCC)OCC.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C8H20O5P2S2.C6H6O2/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4;7-5-1-2-6(8)4-3-5/h5-8H2,1-4H3;1-4,7-8H |
| InChIKey | VONQOXSKTCDCER-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|