C18H34O4 — CID 21248465
2,2,5-trimethylhexanoyl 2,2,5-trimethylhexaneperoxoate (PubChem CID 21248465) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2,2,5-trimethylhexanoyl 2,2,5-trimethylhexaneperoxoate.
| Compound Name | 2,2,5-trimethylhexanoyl 2,2,5-trimethylhexaneperoxoate |
|---|---|
| PubChem CID | 21248465 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 2,2,5-trimethylhexanoyl 2,2,5-trimethylhexaneperoxoate |
| SMILES | CC(C)CCC(C)(C)C(=O)OOC(=O)C(C)(C)CCC(C)C |
| InChI | InChI=1S/C18H34O4/c1-13(2)9-11-17(5,6)15(19)21-22-16(20)18(7,8)12-10-14(3)4/h13-14H,9-12H2,1-8H3 |
| InChIKey | DUZTZEMKNQRMDS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|