C17H24O6 — CID 21248683
2-(cyclohexylmethyl)-4,4-dimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3,3-dicarboxylic acid (PubChem CID 21248683) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-4,4-dimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3,3-dicarboxylic acid.
| Compound Name | 2-(cyclohexylmethyl)-4,4-dimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3,3-dicarboxylic acid |
|---|---|
| PubChem CID | 21248683 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-(cyclohexylmethyl)-4,4-dimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3,3-dicarboxylic acid |
| SMILES | CC1(C)CC23OC2(O3)C(CC2CCCCC2)C1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H24O6/c1-14(2)9-15-17(22-15,23-15)11(8-10-6-4-3-5-7-10)16(14,12(18)19)13(20)21/h10-11H,3-9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | OVQHIJVRUBTBRQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|