About 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone
1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone (PubChem CID 21249468) has the molecular formula C10H8Cl2F2OS
and a molecular weight of 285.14 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone |
| PubChem CID | 21249468 |
| Molecular Formula | C10H8Cl2F2OS |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone |
| SMILES | CCSC(F)(F)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl2F2OS/c1-2-16-10(13,14)9(15)7-4-3-6(11)5-8(7)12/h3-5H,2H2,1H3 |
| InChIKey | OLDJZNQELOCKHO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone?
The IUPAC name of 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone (CID 21249468) is 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone.
What is the SMILES notation for 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone?
The canonical SMILES for 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone is CCSC(F)(F)C(=O)c1ccc(Cl)cc1Cl.
What is the InChIKey of 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone?
The InChIKey is OLDJZNQELOCKHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2F2OS/c1-2-16-10(13,14)9(15)7-4-3-6(11)5-8(7)12/h3-5H,2H2,1H3.
What are the key properties of 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone?
1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone has a molecular weight of 285.14 g/mol, XLogP of 4.52, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dichlorophenyl)-2-ethylsulfanyl-2,2-difluoroethanone is sourced from PubChem (CID 21249468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).