C21H19N3O4S — CID 21249500
N-[4-(2,4,6-trimethoxyphenyl)-1,3-thiazol-2-yl]-1H-indole-2-carboxamide (PubChem CID 21249500) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is N-[4-(2,4,6-trimethoxyphenyl)-1,3-thiazol-2-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[4-(2,4,6-trimethoxyphenyl)-1,3-thiazol-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 21249500 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-[4-(2,4,6-trimethoxyphenyl)-1,3-thiazol-2-yl]-1H-indole-2-carboxamide |
| SMILES | COc1cc(OC)c(-c2csc(NC(=O)c3cc4ccccc4[nH]3)n2)c(OC)c1 |
| InChI | InChI=1S/C21H19N3O4S/c1-26-13-9-17(27-2)19(18(10-13)28-3)16-11-29-21(23-16)24-20(25)15-8-12-6-4-5-7-14(12)22-15/h4-11,22H,1-3H3,(H,23,24,25) |
| InChIKey | DBENOXXRBBWIEE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |