About 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one
3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one (PubChem CID 21250058) has the molecular formula C13H7F3N2O3S
and a molecular weight of 328.27 g/mol. Its IUPAC name is 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one.
Molecular Properties
| Compound Name | 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one |
| PubChem CID | 21250058 |
| Molecular Formula | C13H7F3N2O3S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one |
| SMILES | O=C1c2ccc3cccnc3c2N=CC1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H7F3N2O3S/c14-13(15,16)22(20,21)9-6-18-11-8(12(9)19)4-3-7-2-1-5-17-10(7)11/h1-6,9H |
| InChIKey | LCMWQHYNEMXENA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one?
The IUPAC name of 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one (CID 21250058) is 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one.
What is the SMILES notation for 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one?
The canonical SMILES for 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one is O=C1c2ccc3cccnc3c2N=CC1S(=O)(=O)C(F)(F)F.
What is the InChIKey of 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one?
The InChIKey is LCMWQHYNEMXENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F3N2O3S/c14-13(15,16)22(20,21)9-6-18-11-8(12(9)19)4-3-7-2-1-5-17-10(7)11/h1-6,9H.
What are the key properties of 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one?
3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one has a molecular weight of 328.27 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethylsulfonyl)-3H-1,10-phenanthrolin-4-one is sourced from PubChem (CID 21250058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).