C9H5F14NO — CID 21250086
N,N-bis(2,2,3,3,4,4,4-heptafluorobutyl)formamide (PubChem CID 21250086) has the molecular formula C9H5F14NO and a molecular weight of 409.12 g/mol. Its IUPAC name is N,N-bis(2,2,3,3,4,4,4-heptafluorobutyl)formamide.
| Compound Name | N,N-bis(2,2,3,3,4,4,4-heptafluorobutyl)formamide |
|---|---|
| PubChem CID | 21250086 |
| Molecular Formula | C9H5F14NO |
| Molecular Weight | 409.12 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | N,N-bis(2,2,3,3,4,4,4-heptafluorobutyl)formamide |
| SMILES | O=CN(CC(F)(F)C(F)(F)C(F)(F)F)CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F14NO/c10-4(11,6(14,15)8(18,19)20)1-24(3-25)2-5(12,13)7(16,17)9(21,22)23/h3H,1-2H2 |
| InChIKey | XZQOITJKPLIZHR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.12 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|