About 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one
6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one (PubChem CID 21250095) has the molecular formula C12H6FN3O3
and a molecular weight of 259.20 g/mol. Its IUPAC name is 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one.
Molecular Properties
| Compound Name | 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one |
| PubChem CID | 21250095 |
| Molecular Formula | C12H6FN3O3 |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one |
| SMILES | O=C1c2cc(F)c3cccnc3c2N=CC1[N+](=O)[O-] |
| InChI | InChI=1S/C12H6FN3O3/c13-8-4-7-11(10-6(8)2-1-3-14-10)15-5-9(12(7)17)16(18)19/h1-5,9H |
| InChIKey | SFVYEHVTQSQIPT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 85.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one?
The IUPAC name of 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one (CID 21250095) is 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one.
What is the SMILES notation for 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one?
The canonical SMILES for 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one is O=C1c2cc(F)c3cccnc3c2N=CC1[N+](=O)[O-].
What is the InChIKey of 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one?
The InChIKey is SFVYEHVTQSQIPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6FN3O3/c13-8-4-7-11(10-6(8)2-1-3-14-10)15-5-9(12(7)17)16(18)19/h1-5,9H.
What are the key properties of 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one?
6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one has a molecular weight of 259.20 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-nitro-3H-1,10-phenanthrolin-4-one is sourced from PubChem (CID 21250095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).