C24H26N2O6S — CID 2125062
4-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one (PubChem CID 2125062) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is 4-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 2125062 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 4-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCN(S(=O)(=O)c4ccc5c(c4)OCCO5)CC3)c2cc1C |
| InChI | InChI=1S/C24H26N2O6S/c1-16-11-20-18(13-24(27)32-22(20)12-17(16)2)15-25-5-7-26(8-6-25)33(28,29)19-3-4-21-23(14-19)31-10-9-30-21/h3-4,11-14H,5-10,15H2,1-2H3 |
| InChIKey | UCEKTUIKWCEESV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|