About 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid
5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid (PubChem CID 21250930) has the molecular formula C17H14N2O5
and a molecular weight of 326.31 g/mol. Its IUPAC name is 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid |
| PubChem CID | 21250930 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(C(=O)O)N1C(=O)c2ccc3ccccc3c2C1=O |
| InChI | InChI=1S/C17H14N2O5/c18-13(20)8-7-12(17(23)24)19-15(21)11-6-5-9-3-1-2-4-10(9)14(11)16(19)22/h1-6,12H,7-8H2,(H2,18,20)(H,23,24) |
| InChIKey | VIKHJADZISQYKC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid?
The IUPAC name of 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid (CID 21250930) is 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid.
What is the SMILES notation for 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid?
The canonical SMILES for 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid is NC(=O)CCC(C(=O)O)N1C(=O)c2ccc3ccccc3c2C1=O.
What is the InChIKey of 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid?
The InChIKey is VIKHJADZISQYKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O5/c18-13(20)8-7-12(17(23)24)19-15(21)11-6-5-9-3-1-2-4-10(9)14(11)16(19)22/h1-6,12H,7-8H2,(H2,18,20)(H,23,24).
What are the key properties of 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid?
5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid has a molecular weight of 326.31 g/mol, XLogP of 1.15, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(1,3-dioxobenzo[e]isoindol-2-yl)-5-oxopentanoic acid is sourced from PubChem (CID 21250930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).