C14H16N2O2S — CID 21251011
2-methylsulfonyl-1-phenyl-4,5,6,7-tetrahydrobenzimidazole (PubChem CID 21251011) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-methylsulfonyl-1-phenyl-4,5,6,7-tetrahydrobenzimidazole.
| Compound Name | 2-methylsulfonyl-1-phenyl-4,5,6,7-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 21251011 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-methylsulfonyl-1-phenyl-4,5,6,7-tetrahydrobenzimidazole |
| SMILES | CS(=O)(=O)c1nc2c(n1-c1ccccc1)CCCC2 |
| InChI | InChI=1S/C14H16N2O2S/c1-19(17,18)14-15-12-9-5-6-10-13(12)16(14)11-7-3-2-4-8-11/h2-4,7-8H,5-6,9-10H2,1H3 |
| InChIKey | KEGNXXHEXJYFKT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |