C27H23F4N3O3 — CID 21251047
5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-N-methyl-N-phenylpyridin-2-amine (PubChem CID 21251047) has the molecular formula C27H23F4N3O3 and a molecular weight of 513.49 g/mol. Its IUPAC name is 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-N-methyl-N-phenylpyridin-2-amine.
| Compound Name | 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-N-methyl-N-phenylpyridin-2-amine |
|---|---|
| PubChem CID | 21251047 |
| Molecular Formula | C27H23F4N3O3 |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-N-methyl-N-phenylpyridin-2-amine |
| SMILES | CN(c1ccccc1)c1ccc(C(Cc2cc[n+]([O-])cc2)c2ccc(OC(F)F)c(OC(F)F)c2)cn1 |
| InChI | InChI=1S/C27H23F4N3O3/c1-33(21-5-3-2-4-6-21)25-10-8-20(17-32-25)22(15-18-11-13-34(35)14-12-18)19-7-9-23(36-26(28)29)24(16-19)37-27(30)31/h2-14,16-17,22,26-27H,15H2,1H3 |
| InChIKey | CDQYZMDHFPVYTD-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|