C22H25N3O — CID 21251180
6-[2-[1-(pyrrolidine-2-carbonyl)pyrrolidin-2-yl]ethyl]naphthalene-2-carbonitrile (PubChem CID 21251180) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 6-[2-[1-(pyrrolidine-2-carbonyl)pyrrolidin-2-yl]ethyl]naphthalene-2-carbonitrile.
| Compound Name | 6-[2-[1-(pyrrolidine-2-carbonyl)pyrrolidin-2-yl]ethyl]naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 21251180 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 6-[2-[1-(pyrrolidine-2-carbonyl)pyrrolidin-2-yl]ethyl]naphthalene-2-carbonitrile |
| SMILES | N#Cc1ccc2cc(CCC3CCCN3C(=O)C3CCCN3)ccc2c1 |
| InChI | InChI=1S/C22H25N3O/c23-15-17-6-9-18-13-16(5-8-19(18)14-17)7-10-20-3-2-12-25(20)22(26)21-4-1-11-24-21/h5-6,8-9,13-14,20-21,24H,1-4,7,10-12H2 |
| InChIKey | CTKLTOOCNUGZOU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |