C24H24F3NO2 — CID 21252216
2-[4-(4-ethoxyphenyl)-5,5,5-trifluoropentyl]-6-phenoxypyridine (PubChem CID 21252216) has the molecular formula C24H24F3NO2 and a molecular weight of 415.46 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)-5,5,5-trifluoropentyl]-6-phenoxypyridine.
| Compound Name | 2-[4-(4-ethoxyphenyl)-5,5,5-trifluoropentyl]-6-phenoxypyridine |
|---|---|
| PubChem CID | 21252216 |
| Molecular Formula | C24H24F3NO2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)-5,5,5-trifluoropentyl]-6-phenoxypyridine |
| SMILES | CCOc1ccc(C(CCCc2cccc(Oc3ccccc3)n2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24F3NO2/c1-2-29-20-16-14-18(15-17-20)22(24(25,26)27)12-6-8-19-9-7-13-23(28-19)30-21-10-4-3-5-11-21/h3-5,7,9-11,13-17,22H,2,6,8,12H2,1H3 |
| InChIKey | UAJBGCQULBAVRZ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |