About 3-hydroxy-2,3-dimethylpentanedioic acid
3-hydroxy-2,3-dimethylpentanedioic acid (PubChem CID 21252268) has the molecular formula C7H12O5
and a molecular weight of 176.17 g/mol. Its IUPAC name is 3-hydroxy-2,3-dimethylpentanedioic acid.
Molecular Properties
| Compound Name | 3-hydroxy-2,3-dimethylpentanedioic acid |
| PubChem CID | 21252268 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 3-hydroxy-2,3-dimethylpentanedioic acid |
| SMILES | CC(C(=O)O)C(C)(O)CC(=O)O |
| InChI | InChI=1S/C7H12O5/c1-4(6(10)11)7(2,12)3-5(8)9/h4,12H,3H2,1-2H3,(H,8,9)(H,10,11) |
| InChIKey | CCFYMOIEFAALDH-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-2,3-dimethylpentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,3-dimethylpentanedioic acid?
The IUPAC name of 3-hydroxy-2,3-dimethylpentanedioic acid (CID 21252268) is 3-hydroxy-2,3-dimethylpentanedioic acid.
What is the SMILES notation for 3-hydroxy-2,3-dimethylpentanedioic acid?
The canonical SMILES for 3-hydroxy-2,3-dimethylpentanedioic acid is CC(C(=O)O)C(C)(O)CC(=O)O.
What is the InChIKey of 3-hydroxy-2,3-dimethylpentanedioic acid?
The InChIKey is CCFYMOIEFAALDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O5/c1-4(6(10)11)7(2,12)3-5(8)9/h4,12H,3H2,1-2H3,(H,8,9)(H,10,11).
What are the key properties of 3-hydroxy-2,3-dimethylpentanedioic acid?
3-hydroxy-2,3-dimethylpentanedioic acid has a molecular weight of 176.17 g/mol, XLogP of -0.07, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,3-dimethylpentanedioic acid is sourced from PubChem (CID 21252268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).