3-hydroxy-2,3-dimethylpentanedioic acid

C7H12O5 — CID 21252268

IUPAC3-hydroxy-2,3-dimethylpentanedioic acid
SMILESCC(C(=O)O)C(C)(O)CC(=O)O
InChIInChI=1S/C7H12O5/c1-4(6(10)11)7(2,12)3-5(8)9/h4,12H,3H2,1-2H3,(H,8,9)(H,10,11)
InChIKeyCCFYMOIEFAALDH-UHFFFAOYSA-N
MW176.17 g/mol
LogP-0.07
Rot. Bonds4

About 3-hydroxy-2,3-dimethylpentanedioic acid

3-hydroxy-2,3-dimethylpentanedioic acid (PubChem CID 21252268) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is 3-hydroxy-2,3-dimethylpentanedioic acid.

Molecular Properties

Compound Name3-hydroxy-2,3-dimethylpentanedioic acid
PubChem CID21252268
Molecular FormulaC7H12O5
Molecular Weight176.17 g/mol
Exact Mass176.07
IUPAC Name3-hydroxy-2,3-dimethylpentanedioic acid
SMILESCC(C(=O)O)C(C)(O)CC(=O)O
InChIInChI=1S/C7H12O5/c1-4(6(10)11)7(2,12)3-5(8)9/h4,12H,3H2,1-2H3,(H,8,9)(H,10,11)
InChIKeyCCFYMOIEFAALDH-UHFFFAOYSA-N
XLogP-0.07
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 5-0.07
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-hydroxy-2,3-dimethylpentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-2,3-dimethylpentanedioic acid?
The IUPAC name of 3-hydroxy-2,3-dimethylpentanedioic acid (CID 21252268) is 3-hydroxy-2,3-dimethylpentanedioic acid.
What is the SMILES notation for 3-hydroxy-2,3-dimethylpentanedioic acid?
The canonical SMILES for 3-hydroxy-2,3-dimethylpentanedioic acid is CC(C(=O)O)C(C)(O)CC(=O)O.
What is the InChIKey of 3-hydroxy-2,3-dimethylpentanedioic acid?
The InChIKey is CCFYMOIEFAALDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O5/c1-4(6(10)11)7(2,12)3-5(8)9/h4,12H,3H2,1-2H3,(H,8,9)(H,10,11).
What are the key properties of 3-hydroxy-2,3-dimethylpentanedioic acid?
3-hydroxy-2,3-dimethylpentanedioic acid has a molecular weight of 176.17 g/mol, XLogP of -0.07, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,3-dimethylpentanedioic acid is sourced from PubChem (CID 21252268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).